About N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide
N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 62896429) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| PubChem CID | 62896429 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)C2=COCCO2)CN1 |
| InChI | InChI=1S/C10H14N2O4/c13-9-2-1-7(5-11-9)12-10(14)8-6-15-3-4-16-8/h6-7H,1-5H2,(H,11,13)(H,12,14) |
| InChIKey | CJMFFWMWQUBXPZ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The IUPAC name of N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide (CID 62896429) is N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the SMILES notation for N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The canonical SMILES for N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide is O=C1CCC(NC(=O)C2=COCCO2)CN1.
What is the InChIKey of N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The InChIKey is CJMFFWMWQUBXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c13-9-2-1-7(5-11-9)12-10(14)8-6-15-3-4-16-8/h6-7H,1-5H2,(H,11,13)(H,12,14).
What are the key properties of N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide has a molecular weight of 226.23 g/mol, XLogP of -0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-oxopiperidin-3-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide is sourced from PubChem (CID 62896429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).