C20H12O4 — CID 628965
13,20-dihydroxypentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),4,6,8,12,14,16,18-octaene-3,10-dione (PubChem CID 628965) has the molecular formula C20H12O4 and a molecular weight of 316.31 g/mol. Its IUPAC name is 13,20-dihydroxypentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),4,6,8,12,14,16,18-octaene-3,10-dione.
| Compound Name | 13,20-dihydroxypentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),4,6,8,12,14,16,18-octaene-3,10-dione |
|---|---|
| PubChem CID | 628965 |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 13,20-dihydroxypentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),4,6,8,12,14,16,18-octaene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)C2c3c(c(O)c4ccccc4c3O)C12 |
| InChI | InChI=1S/C20H12O4/c21-17-9-5-1-2-6-10(9)18(22)14-13(17)15-16(14)20(24)12-8-4-3-7-11(12)19(15)23/h1-8,13-14,23-24H |
| InChIKey | MVGCIFXFMUMGSO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|