C12H15N3OS — CID 62897282
4-[(4-propan-2-ylphenyl)methyl]-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 62897282) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-[(4-propan-2-ylphenyl)methyl]-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-[(4-propan-2-ylphenyl)methyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62897282 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-[(4-propan-2-ylphenyl)methyl]-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | CC(C)c1ccc(Cn2c(=O)[nH][nH]c2=S)cc1 |
| InChI | InChI=1S/C12H15N3OS/c1-8(2)10-5-3-9(4-6-10)7-15-11(16)13-14-12(15)17/h3-6,8H,7H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | VFHJVZDIVQGTGK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|