About 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile
6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile (PubChem CID 62898094) has the molecular formula C9H7N5OS
and a molecular weight of 233.26 g/mol. Its IUPAC name is 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile |
| PubChem CID | 62898094 |
| Molecular Formula | C9H7N5OS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile |
| SMILES | Cn1c(Sc2ccc(C#N)cn2)n[nH]c1=O |
| InChI | InChI=1S/C9H7N5OS/c1-14-8(15)12-13-9(14)16-7-3-2-6(4-10)5-11-7/h2-3,5H,1H3,(H,12,15) |
| InChIKey | DLCUMMORQHKRNN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The IUPAC name of 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile (CID 62898094) is 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile is Cn1c(Sc2ccc(C#N)cn2)n[nH]c1=O.
What is the InChIKey of 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
The InChIKey is DLCUMMORQHKRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5OS/c1-14-8(15)12-13-9(14)16-7-3-2-6(4-10)5-11-7/h2-3,5H,1H3,(H,12,15).
What are the key properties of 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile?
6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile has a molecular weight of 233.26 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carbonitrile is sourced from PubChem (CID 62898094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).