C11H18N2O2 — CID 62899658
2-[1-(furan-2-yl)propan-2-ylamino]butanamide (PubChem CID 62899658) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[1-(furan-2-yl)propan-2-ylamino]butanamide.
| Compound Name | 2-[1-(furan-2-yl)propan-2-ylamino]butanamide |
|---|---|
| PubChem CID | 62899658 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[1-(furan-2-yl)propan-2-ylamino]butanamide |
| SMILES | CCC(NC(C)Cc1ccco1)C(N)=O |
| InChI | InChI=1S/C11H18N2O2/c1-3-10(11(12)14)13-8(2)7-9-5-4-6-15-9/h4-6,8,10,13H,3,7H2,1-2H3,(H2,12,14) |
| InChIKey | SAVUYTUQFHIVQG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |