C15H17ClOS — CID 62899782
1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylphenyl)propan-2-ol (PubChem CID 62899782) has the molecular formula C15H17ClOS and a molecular weight of 280.82 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 62899782 |
| Molecular Formula | C15H17ClOS |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylphenyl)propan-2-ol |
| SMILES | Cc1ccc(CC(O)Cc2ccc(Cl)s2)cc1C |
| InChI | InChI=1S/C15H17ClOS/c1-10-3-4-12(7-11(10)2)8-13(17)9-14-5-6-15(16)18-14/h3-7,13,17H,8-9H2,1-2H3 |
| InChIKey | WWSKWKULHPALOA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |