About 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine
1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine (PubChem CID 62900326) has the molecular formula C14H16N2O2S2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine.
Molecular Properties
| Compound Name | 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine |
| PubChem CID | 62900326 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-20(18)7-6-12(10-20)15-8-14-16-13(9-19-14)11-4-2-1-3-5-11/h1-5,9,12,15H,6-8,10H2 |
| InChIKey | YWBRHURRDVYGOS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine?
The IUPAC name of 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine (CID 62900326) is 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine.
What is the SMILES notation for 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine?
The canonical SMILES for 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine is O=S1(=O)CCC(NCc2nc(-c3ccccc3)cs2)C1.
What is the InChIKey of 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine?
The InChIKey is YWBRHURRDVYGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S2/c17-20(18)7-6-12(10-20)15-8-14-16-13(9-19-14)11-4-2-1-3-5-11/h1-5,9,12,15H,6-8,10H2.
What are the key properties of 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine?
1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine has a molecular weight of 308.43 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]thiolan-3-amine is sourced from PubChem (CID 62900326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).