C11H20N2O3 — CID 62900440
2-[1-(1-amino-1-oxobutan-2-yl)piperidin-2-yl]acetic acid (PubChem CID 62900440) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[1-(1-amino-1-oxobutan-2-yl)piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-(1-amino-1-oxobutan-2-yl)piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 62900440 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-[1-(1-amino-1-oxobutan-2-yl)piperidin-2-yl]acetic acid |
| SMILES | CCC(C(N)=O)N1CCCCC1CC(=O)O |
| InChI | InChI=1S/C11H20N2O3/c1-2-9(11(12)16)13-6-4-3-5-8(13)7-10(14)15/h8-9H,2-7H2,1H3,(H2,12,16)(H,14,15) |
| InChIKey | GAKPPVRLEYYUPI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |