About 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine
5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (PubChem CID 62900568) has the molecular formula C12H13FN4
and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 62900568 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1ncc(-c2ccc(F)cc2)c(N)n1 |
| InChI | InChI=1S/C12H13FN4/c1-17(2)12-15-7-10(11(14)16-12)8-3-5-9(13)6-4-8/h3-7H,1-2H3,(H2,14,15,16) |
| InChIKey | AYZWXVZGDVKREO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine (CID 62900568) is 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine is CN(C)c1ncc(-c2ccc(F)cc2)c(N)n1.
What is the InChIKey of 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
The InChIKey is AYZWXVZGDVKREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN4/c1-17(2)12-15-7-10(11(14)16-12)8-3-5-9(13)6-4-8/h3-7H,1-2H3,(H2,14,15,16).
What are the key properties of 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine?
5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine has a molecular weight of 232.26 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2-N,2-N-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 62900568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).