About 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide
2-[propyl(2,2,2-trifluoroethyl)amino]butanamide (PubChem CID 62900855) has the molecular formula C9H17F3N2O
and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide.
Molecular Properties
| Compound Name | 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide |
| PubChem CID | 62900855 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide |
| SMILES | CCCN(CC(F)(F)F)C(CC)C(N)=O |
| InChI | InChI=1S/C9H17F3N2O/c1-3-5-14(6-9(10,11)12)7(4-2)8(13)15/h7H,3-6H2,1-2H3,(H2,13,15) |
| InChIKey | HXQJCYYWKIKLOF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide?
The IUPAC name of 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide (CID 62900855) is 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide.
What is the SMILES notation for 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide?
The canonical SMILES for 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide is CCCN(CC(F)(F)F)C(CC)C(N)=O.
What is the InChIKey of 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide?
The InChIKey is HXQJCYYWKIKLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O/c1-3-5-14(6-9(10,11)12)7(4-2)8(13)15/h7H,3-6H2,1-2H3,(H2,13,15).
What are the key properties of 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide?
2-[propyl(2,2,2-trifluoroethyl)amino]butanamide has a molecular weight of 226.24 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propyl(2,2,2-trifluoroethyl)amino]butanamide is sourced from PubChem (CID 62900855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).