C12H16N2O6 — CID 62901575
2-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide (PubChem CID 62901575) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide.
| Compound Name | 2-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide |
|---|---|
| PubChem CID | 62901575 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanamide |
| SMILES | CCC(Oc1cc([N+](=O)[O-])c(CO)cc1OC)C(N)=O |
| InChI | InChI=1S/C12H16N2O6/c1-3-9(12(13)16)20-11-5-8(14(17)18)7(6-15)4-10(11)19-2/h4-5,9,15H,3,6H2,1-2H3,(H2,13,16) |
| InChIKey | YRVJPSJACIRVJD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|