About 2-(butylamino)butanamide
2-(butylamino)butanamide (PubChem CID 62901736) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-(butylamino)butanamide.
Molecular Properties
| Compound Name | 2-(butylamino)butanamide |
| PubChem CID | 62901736 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-(butylamino)butanamide |
| SMILES | CCCCNC(CC)C(N)=O |
| InChI | InChI=1S/C8H18N2O/c1-3-5-6-10-7(4-2)8(9)11/h7,10H,3-6H2,1-2H3,(H2,9,11) |
| InChIKey | HYABGKZKNKFERQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)butanamide?
The IUPAC name of 2-(butylamino)butanamide (CID 62901736) is 2-(butylamino)butanamide.
What is the SMILES notation for 2-(butylamino)butanamide?
The canonical SMILES for 2-(butylamino)butanamide is CCCCNC(CC)C(N)=O.
What is the InChIKey of 2-(butylamino)butanamide?
The InChIKey is HYABGKZKNKFERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-5-6-10-7(4-2)8(9)11/h7,10H,3-6H2,1-2H3,(H2,9,11).
What are the key properties of 2-(butylamino)butanamide?
2-(butylamino)butanamide has a molecular weight of 158.25 g/mol, XLogP of 0.64, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)butanamide is sourced from PubChem (CID 62901736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).