About 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide
4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide (PubChem CID 62902584) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide |
| PubChem CID | 62902584 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)Nc2cnoc2)cc1N |
| InChI | InChI=1S/C9H9N3O2S/c1-5-7(10)2-8(15-5)9(13)12-6-3-11-14-4-6/h2-4H,10H2,1H3,(H,12,13) |
| InChIKey | NQLWZXIBXRQFAN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The IUPAC name of 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide (CID 62902584) is 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide.
What is the SMILES notation for 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The canonical SMILES for 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide is Cc1sc(C(=O)Nc2cnoc2)cc1N.
What is the InChIKey of 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The InChIKey is NQLWZXIBXRQFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-5-7(10)2-8(15-5)9(13)12-6-3-11-14-4-6/h2-4H,10H2,1H3,(H,12,13).
What are the key properties of 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide has a molecular weight of 223.26 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-methyl-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide is sourced from PubChem (CID 62902584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).