C13H14N4O4 — CID 62904145
2-nitro-N-(1,2-oxazol-3-yl)-5-(propylamino)benzamide (PubChem CID 62904145) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-nitro-N-(1,2-oxazol-3-yl)-5-(propylamino)benzamide.
| Compound Name | 2-nitro-N-(1,2-oxazol-3-yl)-5-(propylamino)benzamide |
|---|---|
| PubChem CID | 62904145 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-nitro-N-(1,2-oxazol-3-yl)-5-(propylamino)benzamide |
| SMILES | CCCNc1ccc([N+](=O)[O-])c(C(=O)Nc2ccon2)c1 |
| InChI | InChI=1S/C13H14N4O4/c1-2-6-14-9-3-4-11(17(19)20)10(8-9)13(18)15-12-5-7-21-16-12/h3-5,7-8,14H,2,6H2,1H3,(H,15,16,18) |
| InChIKey | KFNUJMRVMDIDMN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|