C12H12F2N4O2 — CID 62904621
N-(2,3-difluoro-6-nitrophenyl)-1-propan-2-ylpyrazol-4-amine (PubChem CID 62904621) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-(2,3-difluoro-6-nitrophenyl)-1-propan-2-ylpyrazol-4-amine.
| Compound Name | N-(2,3-difluoro-6-nitrophenyl)-1-propan-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 62904621 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(2,3-difluoro-6-nitrophenyl)-1-propan-2-ylpyrazol-4-amine |
| SMILES | CC(C)n1cc(Nc2c([N+](=O)[O-])ccc(F)c2F)cn1 |
| InChI | InChI=1S/C12H12F2N4O2/c1-7(2)17-6-8(5-15-17)16-12-10(18(19)20)4-3-9(13)11(12)14/h3-7,16H,1-2H3 |
| InChIKey | NWUBWDYVALBPFU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|