C35H48N2O7 — CID 6290641
(4E)-4-[(4-butoxy-2-methylphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6290641) has the molecular formula C35H48N2O7 and a molecular weight of 608.78 g/mol. Its IUPAC name is (4E)-4-[(4-butoxy-2-methylphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-butoxy-2-methylphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6290641 |
| Molecular Formula | C35H48N2O7 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | (4E)-4-[(4-butoxy-2-methylphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccc(OCCCC)cc3C)C(=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C35H48N2O7/c1-5-7-9-20-44-29-14-11-26(24-30(29)41-4)32-31(33(38)28-13-12-27(23-25(28)3)43-19-8-6-2)34(39)35(40)37(32)16-10-15-36-17-21-42-22-18-36/h11-14,23-24,32,38H,5-10,15-22H2,1-4H3/b33-31+ |
| InChIKey | OXZYIHYYALYLAX-QOSDPKFLSA-N |
| XLogP | 5.90 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|