About N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine
N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine (PubChem CID 62906432) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine |
| PubChem CID | 62906432 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine |
| SMILES | CNCC1(Cc2cscn2)CCOCC1 |
| InChI | InChI=1S/C11H18N2OS/c1-12-8-11(2-4-14-5-3-11)6-10-7-15-9-13-10/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | ZFIWUEDIJZCHTJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine?
The IUPAC name of N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine (CID 62906432) is N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine.
What is the SMILES notation for N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine?
The canonical SMILES for N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine is CNCC1(Cc2cscn2)CCOCC1.
What is the InChIKey of N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine?
The InChIKey is ZFIWUEDIJZCHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-12-8-11(2-4-14-5-3-11)6-10-7-15-9-13-10/h7,9,12H,2-6,8H2,1H3.
What are the key properties of N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine?
N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine has a molecular weight of 226.34 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methanamine is sourced from PubChem (CID 62906432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).