About 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine
4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine (PubChem CID 62906909) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine |
| PubChem CID | 62906909 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1c(C2CCOCC2)noc1N |
| InChI | InChI=1S/C9H14N2O2/c1-6-8(11-13-9(6)10)7-2-4-12-5-3-7/h7H,2-5,10H2,1H3 |
| InChIKey | ROCOXESJNLSOFA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine?
The IUPAC name of 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine (CID 62906909) is 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine.
What is the SMILES notation for 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine?
The canonical SMILES for 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine is Cc1c(C2CCOCC2)noc1N.
What is the InChIKey of 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine?
The InChIKey is ROCOXESJNLSOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6-8(11-13-9(6)10)7-2-4-12-5-3-7/h7H,2-5,10H2,1H3.
What are the key properties of 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine?
4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine has a molecular weight of 182.22 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(oxan-4-yl)-1,2-oxazol-5-amine is sourced from PubChem (CID 62906909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).