C13H18FNO — CID 62907400
1-(4-fluorophenyl)-N-methyl-1-(oxan-4-yl)methanamine (PubChem CID 62907400) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methyl-1-(oxan-4-yl)methanamine.
| Compound Name | 1-(4-fluorophenyl)-N-methyl-1-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 62907400 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methyl-1-(oxan-4-yl)methanamine |
| SMILES | CNC(c1ccc(F)cc1)C1CCOCC1 |
| InChI | InChI=1S/C13H18FNO/c1-15-13(11-6-8-16-9-7-11)10-2-4-12(14)5-3-10/h2-5,11,13,15H,6-9H2,1H3 |
| InChIKey | MPHZKFDYGHQHSW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |