C13H25NO3S — CID 62907476
N-[[4-(1,1-dioxothiolan-3-yl)oxan-4-yl]methyl]propan-2-amine (PubChem CID 62907476) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is N-[[4-(1,1-dioxothiolan-3-yl)oxan-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[4-(1,1-dioxothiolan-3-yl)oxan-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62907476 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[[4-(1,1-dioxothiolan-3-yl)oxan-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(C2CCS(=O)(=O)C2)CCOCC1 |
| InChI | InChI=1S/C13H25NO3S/c1-11(2)14-10-13(4-6-17-7-5-13)12-3-8-18(15,16)9-12/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | QMJNIVFKZUCKIT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |