C14H17ClN2O — CID 62909232
N-[5-(3-aminoprop-1-ynyl)-2-chlorophenyl]pentanamide (PubChem CID 62909232) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-2-chlorophenyl]pentanamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-2-chlorophenyl]pentanamide |
|---|---|
| PubChem CID | 62909232 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-2-chlorophenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cc(C#CCN)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O/c1-2-3-6-14(18)17-13-10-11(5-4-9-16)7-8-12(13)15/h7-8,10H,2-3,6,9,16H2,1H3,(H,17,18) |
| InChIKey | BYCMBIXIKAEUKC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|