C13H20ClNO2 — CID 62911552
1-[3-chloro-4-(2-ethoxyethoxy)phenyl]-N-methylethanamine (PubChem CID 62911552) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-ethoxyethoxy)phenyl]-N-methylethanamine.
| Compound Name | 1-[3-chloro-4-(2-ethoxyethoxy)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 62911552 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[3-chloro-4-(2-ethoxyethoxy)phenyl]-N-methylethanamine |
| SMILES | CCOCCOc1ccc(C(C)NC)cc1Cl |
| InChI | InChI=1S/C13H20ClNO2/c1-4-16-7-8-17-13-6-5-11(9-12(13)14)10(2)15-3/h5-6,9-10,15H,4,7-8H2,1-3H3 |
| InChIKey | FXGPSTPIZBFSIN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|