C15H19BrN4 — CID 62913700
[2-[(4-bromophenyl)methyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 62913700) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is [2-[(4-bromophenyl)methyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(4-bromophenyl)methyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62913700 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2-[(4-bromophenyl)methyl]-6-methyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(Cc2ccc(Br)cc2)nc(NN)c1C(C)C |
| InChI | InChI=1S/C15H19BrN4/c1-9(2)14-10(3)18-13(19-15(14)20-17)8-11-4-6-12(16)7-5-11/h4-7,9H,8,17H2,1-3H3,(H,18,19,20) |
| InChIKey | LJZUQFZEKHBCCR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|