C11H12N2O2 — CID 62914521
1-(1,2-oxazol-4-yl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 62914521) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(1,2-oxazol-4-yl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(1,2-oxazol-4-yl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 62914521 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(1,2-oxazol-4-yl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2-c1cnoc1 |
| InChI | InChI=1S/C11H12N2O2/c14-11-3-1-2-10-9(11)4-5-13(10)8-6-12-15-7-8/h4-7,11,14H,1-3H2 |
| InChIKey | IVEYLIZBAJYACQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |