About 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline
5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline (PubChem CID 62914874) has the molecular formula C8H7BrClF2N
and a molecular weight of 270.50 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline |
| PubChem CID | 62914874 |
| Molecular Formula | C8H7BrClF2N |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 268.94 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C8H7BrClF2N/c9-5-1-2-6(10)7(3-5)13-4-8(11)12/h1-3,8,13H,4H2 |
| InChIKey | RBVBJVFFHJONCB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline?
The IUPAC name of 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline (CID 62914874) is 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline.
What is the SMILES notation for 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline?
The canonical SMILES for 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline is FC(F)CNc1cc(Br)ccc1Cl.
What is the InChIKey of 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline?
The InChIKey is RBVBJVFFHJONCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClF2N/c9-5-1-2-6(10)7(3-5)13-4-8(11)12/h1-3,8,13H,4H2.
What are the key properties of 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline?
5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline has a molecular weight of 270.50 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-N-(2,2-difluoroethyl)aniline is sourced from PubChem (CID 62914874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).