About 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline
5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 62915047) has the molecular formula C8H6BrClF3N
and a molecular weight of 288.49 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline |
| PubChem CID | 62915047 |
| Molecular Formula | C8H6BrClF3N |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)(F)CNc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C8H6BrClF3N/c9-5-1-2-6(10)7(3-5)14-4-8(11,12)13/h1-3,14H,4H2 |
| InChIKey | RVJRTYXILJBOCE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline?
The IUPAC name of 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline (CID 62915047) is 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline.
What is the SMILES notation for 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline?
The canonical SMILES for 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline is FC(F)(F)CNc1cc(Br)ccc1Cl.
What is the InChIKey of 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline?
The InChIKey is RVJRTYXILJBOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrClF3N/c9-5-1-2-6(10)7(3-5)14-4-8(11,12)13/h1-3,14H,4H2.
What are the key properties of 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline?
5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline has a molecular weight of 288.49 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)aniline is sourced from PubChem (CID 62915047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).