C14H15F3N2 — CID 62915678
5,6,8-trifluoro-N,2-dimethyl-3-propan-2-ylquinolin-4-amine (PubChem CID 62915678) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 5,6,8-trifluoro-N,2-dimethyl-3-propan-2-ylquinolin-4-amine.
| Compound Name | 5,6,8-trifluoro-N,2-dimethyl-3-propan-2-ylquinolin-4-amine |
|---|---|
| PubChem CID | 62915678 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5,6,8-trifluoro-N,2-dimethyl-3-propan-2-ylquinolin-4-amine |
| SMILES | CNc1c(C(C)C)c(C)nc2c(F)cc(F)c(F)c12 |
| InChI | InChI=1S/C14H15F3N2/c1-6(2)10-7(3)19-13-9(16)5-8(15)12(17)11(13)14(10)18-4/h5-6H,1-4H3,(H,18,19) |
| InChIKey | JOKVBGABBRJDQE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|