C15H20BrFN2O2 — CID 62915911
ethyl 2-(3-bromo-4-fluorophenyl)-2-piperazin-1-ylpropanoate (PubChem CID 62915911) has the molecular formula C15H20BrFN2O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is ethyl 2-(3-bromo-4-fluorophenyl)-2-piperazin-1-ylpropanoate.
| Compound Name | ethyl 2-(3-bromo-4-fluorophenyl)-2-piperazin-1-ylpropanoate |
|---|---|
| PubChem CID | 62915911 |
| Molecular Formula | C15H20BrFN2O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | ethyl 2-(3-bromo-4-fluorophenyl)-2-piperazin-1-ylpropanoate |
| SMILES | CCOC(=O)C(C)(c1ccc(F)c(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C15H20BrFN2O2/c1-3-21-14(20)15(2,19-8-6-18-7-9-19)11-4-5-13(17)12(16)10-11/h4-5,10,18H,3,6-9H2,1-2H3 |
| InChIKey | LCSYWEUCZWYORW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |