C13H11N5O2 — CID 62915996
1-hydrazinyl-N-(1,2-oxazol-4-yl)isoquinoline-3-carboxamide (PubChem CID 62915996) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-hydrazinyl-N-(1,2-oxazol-4-yl)isoquinoline-3-carboxamide.
| Compound Name | 1-hydrazinyl-N-(1,2-oxazol-4-yl)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 62915996 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-hydrazinyl-N-(1,2-oxazol-4-yl)isoquinoline-3-carboxamide |
| SMILES | NNc1nc(C(=O)Nc2cnoc2)cc2ccccc12 |
| InChI | InChI=1S/C13H11N5O2/c14-18-12-10-4-2-1-3-8(10)5-11(17-12)13(19)16-9-6-15-20-7-9/h1-7H,14H2,(H,16,19)(H,17,18) |
| InChIKey | UVWZEBJIGXBYOX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|