C10H13BrN2O2 — CID 62916212
(4-bromo-1-methylpyrrol-2-yl)-(3-hydroxypyrrolidin-1-yl)methanone (PubChem CID 62916212) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is (4-bromo-1-methylpyrrol-2-yl)-(3-hydroxypyrrolidin-1-yl)methanone.
| Compound Name | (4-bromo-1-methylpyrrol-2-yl)-(3-hydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 62916212 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (4-bromo-1-methylpyrrol-2-yl)-(3-hydroxypyrrolidin-1-yl)methanone |
| SMILES | Cn1cc(Br)cc1C(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C10H13BrN2O2/c1-12-5-7(11)4-9(12)10(15)13-3-2-8(14)6-13/h4-5,8,14H,2-3,6H2,1H3 |
| InChIKey | QANQBUNZGNWEOA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |