C14H15NO2S — CID 62916236
(3-hydroxypyrrolidin-1-yl)-(3-methyl-1-benzothiophen-2-yl)methanone (PubChem CID 62916236) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is (3-hydroxypyrrolidin-1-yl)-(3-methyl-1-benzothiophen-2-yl)methanone.
| Compound Name | (3-hydroxypyrrolidin-1-yl)-(3-methyl-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 62916236 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3-hydroxypyrrolidin-1-yl)-(3-methyl-1-benzothiophen-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(O)C2)sc2ccccc12 |
| InChI | InChI=1S/C14H15NO2S/c1-9-11-4-2-3-5-12(11)18-13(9)14(17)15-7-6-10(16)8-15/h2-5,10,16H,6-8H2,1H3 |
| InChIKey | NTGHDOVYPQRKSJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |