C8H14N2O3 — CID 62917262
N-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]acetamide (PubChem CID 62917262) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is N-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | N-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 62917262 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N-[2-(3-hydroxypyrrolidin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C8H14N2O3/c1-6(11)9-4-8(13)10-3-2-7(12)5-10/h7,12H,2-5H2,1H3,(H,9,11) |
| InChIKey | IPOMKKHSAZFLIG-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |