C12H12ClFN2O — CID 62920751
2-[2-chloro-2-(3-fluoro-4-methoxyphenyl)ethyl]-1H-imidazole (PubChem CID 62920751) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 2-[2-chloro-2-(3-fluoro-4-methoxyphenyl)ethyl]-1H-imidazole.
| Compound Name | 2-[2-chloro-2-(3-fluoro-4-methoxyphenyl)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 62920751 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-[2-chloro-2-(3-fluoro-4-methoxyphenyl)ethyl]-1H-imidazole |
| SMILES | COc1ccc(C(Cl)Cc2ncc[nH]2)cc1F |
| InChI | InChI=1S/C12H12ClFN2O/c1-17-11-3-2-8(6-10(11)14)9(13)7-12-15-4-5-16-12/h2-6,9H,7H2,1H3,(H,15,16) |
| InChIKey | GJQJSTYIUDMWAY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|