C13H18N4O4 — CID 62921611
ethyl 5-amino-2-[bis(2-amino-2-oxoethyl)amino]benzoate (PubChem CID 62921611) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 5-amino-2-[bis(2-amino-2-oxoethyl)amino]benzoate.
| Compound Name | ethyl 5-amino-2-[bis(2-amino-2-oxoethyl)amino]benzoate |
|---|---|
| PubChem CID | 62921611 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl 5-amino-2-[bis(2-amino-2-oxoethyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(N)ccc1N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C13H18N4O4/c1-2-21-13(20)9-5-8(14)3-4-10(9)17(6-11(15)18)7-12(16)19/h3-5H,2,6-7,14H2,1H3,(H2,15,18)(H2,16,19) |
| InChIKey | NIIQUZBRYKVEDR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|