C12H13N5O3 — CID 62922613
2-[(2-amino-2-oxoethyl)-(3-formylimidazo[1,2-a]pyridin-2-yl)amino]acetamide (PubChem CID 62922613) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(3-formylimidazo[1,2-a]pyridin-2-yl)amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(3-formylimidazo[1,2-a]pyridin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 62922613 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(3-formylimidazo[1,2-a]pyridin-2-yl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)c1nc2ccccn2c1C=O |
| InChI | InChI=1S/C12H13N5O3/c13-9(19)5-16(6-10(14)20)12-8(7-18)17-4-2-1-3-11(17)15-12/h1-4,7H,5-6H2,(H2,13,19)(H2,14,20) |
| InChIKey | SVZWXTNABQSXEZ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|