About N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine
N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine (PubChem CID 62922768) has the molecular formula C11H17F2N3O2S
and a molecular weight of 293.34 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine |
| PubChem CID | 62922768 |
| Molecular Formula | C11H17F2N3O2S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine |
| SMILES | NCCN(CCN)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H17F2N3O2S/c12-11(13)19(17,18)10-4-2-1-3-9(10)16(7-5-14)8-6-15/h1-4,11H,5-8,14-15H2 |
| InChIKey | QWPREUMUAFAVFT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The IUPAC name of N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine (CID 62922768) is N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine.
What is the SMILES notation for N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The canonical SMILES for N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine is NCCN(CCN)c1ccccc1S(=O)(=O)C(F)F.
What is the InChIKey of N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
The InChIKey is QWPREUMUAFAVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N3O2S/c12-11(13)19(17,18)10-4-2-1-3-9(10)16(7-5-14)8-6-15/h1-4,11H,5-8,14-15H2.
What are the key properties of N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine?
N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine has a molecular weight of 293.34 g/mol, XLogP of 0.41, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-aminoethyl)-N'-[2-(difluoromethylsulfonyl)phenyl]ethane-1,2-diamine is sourced from PubChem (CID 62922768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).