About (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol
(4-pyridin-2-yl-1,3-thiazol-2-yl)methanol (PubChem CID 62923408) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 62923408 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol |
| SMILES | OCc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C9H8N2OS/c12-5-9-11-8(6-13-9)7-3-1-2-4-10-7/h1-4,6,12H,5H2 |
| InChIKey | HRRZIYSZZKAVOA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol?
The IUPAC name of (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol (CID 62923408) is (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol is OCc1nc(-c2ccccn2)cs1.
What is the InChIKey of (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol?
The InChIKey is HRRZIYSZZKAVOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c12-5-9-11-8(6-13-9)7-3-1-2-4-10-7/h1-4,6,12H,5H2.
What are the key properties of (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol?
(4-pyridin-2-yl-1,3-thiazol-2-yl)methanol has a molecular weight of 192.24 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 62923408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).