C11H13ClN4O4 — CID 62923477
2-[(2-amino-2-oxoethyl)-[(4-chloro-3-nitrophenyl)methyl]amino]acetamide (PubChem CID 62923477) has the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(4-chloro-3-nitrophenyl)methyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(4-chloro-3-nitrophenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 62923477 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(4-chloro-3-nitrophenyl)methyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13ClN4O4/c12-8-2-1-7(3-9(8)16(19)20)4-15(5-10(13)17)6-11(14)18/h1-3H,4-6H2,(H2,13,17)(H2,14,18) |
| InChIKey | NWXQCNGVZUZNIN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|