C11H15N3O3 — CID 62923495
2-[N-(2-amino-2-oxoethyl)-4-(hydroxymethyl)anilino]acetamide (PubChem CID 62923495) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-[N-(2-amino-2-oxoethyl)-4-(hydroxymethyl)anilino]acetamide.
| Compound Name | 2-[N-(2-amino-2-oxoethyl)-4-(hydroxymethyl)anilino]acetamide |
|---|---|
| PubChem CID | 62923495 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[N-(2-amino-2-oxoethyl)-4-(hydroxymethyl)anilino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C11H15N3O3/c12-10(16)5-14(6-11(13)17)9-3-1-8(7-15)2-4-9/h1-4,15H,5-7H2,(H2,12,16)(H2,13,17) |
| InChIKey | MVCFXZSQHDORJD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|