About 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine
2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine (PubChem CID 62924166) has the molecular formula C14H18ClN3O2S
and a molecular weight of 327.84 g/mol. Its IUPAC name is 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine |
| PubChem CID | 62924166 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine |
| SMILES | CC1(C)CCN(S(=O)(=O)c2c(Cl)nc3ccccn23)CC1 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-14(2)6-9-17(10-7-14)21(19,20)13-12(15)16-11-5-3-4-8-18(11)13/h3-5,8H,6-7,9-10H2,1-2H3 |
| InChIKey | FOUNMZCJZYBCJG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine?
The IUPAC name of 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine (CID 62924166) is 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine is CC1(C)CCN(S(=O)(=O)c2c(Cl)nc3ccccn23)CC1.
What is the InChIKey of 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine?
The InChIKey is FOUNMZCJZYBCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O2S/c1-14(2)6-9-17(10-7-14)21(19,20)13-12(15)16-11-5-3-4-8-18(11)13/h3-5,8H,6-7,9-10H2,1-2H3.
What are the key properties of 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine?
2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine has a molecular weight of 327.84 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(4,4-dimethylpiperidin-1-yl)sulfonylimidazo[1,2-a]pyridine is sourced from PubChem (CID 62924166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).