C15H19N3O3 — CID 62927691
1-[2-(2-methoxyphenyl)-2-(methylamino)ethyl]-4-methylpyrazine-2,3-dione (PubChem CID 62927691) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)-2-(methylamino)ethyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[2-(2-methoxyphenyl)-2-(methylamino)ethyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62927691 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)-2-(methylamino)ethyl]-4-methylpyrazine-2,3-dione |
| SMILES | CNC(Cn1ccn(C)c(=O)c1=O)c1ccccc1OC |
| InChI | InChI=1S/C15H19N3O3/c1-16-12(11-6-4-5-7-13(11)21-3)10-18-9-8-17(2)14(19)15(18)20/h4-9,12,16H,10H2,1-3H3 |
| InChIKey | ZHPIRTPNVOHMSD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|