About 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one
3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one (PubChem CID 62927930) has the molecular formula C13H13F2N3O
and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one |
| PubChem CID | 62927930 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NCc2ccc(F)cc2F)c1=O |
| InChI | InChI=1S/C13H13F2N3O/c1-2-18-6-5-16-12(13(18)19)17-8-9-3-4-10(14)7-11(9)15/h3-7H,2,8H2,1H3,(H,16,17) |
| InChIKey | IOZGFOKHNHXUSM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one?
The IUPAC name of 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one (CID 62927930) is 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one.
What is the SMILES notation for 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one?
The canonical SMILES for 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one is CCn1ccnc(NCc2ccc(F)cc2F)c1=O.
What is the InChIKey of 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one?
The InChIKey is IOZGFOKHNHXUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O/c1-2-18-6-5-16-12(13(18)19)17-8-9-3-4-10(14)7-11(9)15/h3-7H,2,8H2,1H3,(H,16,17).
What are the key properties of 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one?
3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one has a molecular weight of 265.26 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)methylamino]-1-ethylpyrazin-2-one is sourced from PubChem (CID 62927930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).