C15H27N3O2 — CID 62928104
1-tert-butyl-3-[2-(3-methylbutoxy)ethylamino]pyrazin-2-one (PubChem CID 62928104) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(3-methylbutoxy)ethylamino]pyrazin-2-one.
| Compound Name | 1-tert-butyl-3-[2-(3-methylbutoxy)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 62928104 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-tert-butyl-3-[2-(3-methylbutoxy)ethylamino]pyrazin-2-one |
| SMILES | CC(C)CCOCCNc1nccn(C(C)(C)C)c1=O |
| InChI | InChI=1S/C15H27N3O2/c1-12(2)6-10-20-11-8-17-13-14(19)18(9-7-16-13)15(3,4)5/h7,9,12H,6,8,10-11H2,1-5H3,(H,16,17) |
| InChIKey | SZUKRCJAZPXFEY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|