C14H17N3O3 — CID 62928552
1-[3-(2-aminophenoxy)propyl]-4-methylpyrazine-2,3-dione (PubChem CID 62928552) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-[3-(2-aminophenoxy)propyl]-4-methylpyrazine-2,3-dione.
| Compound Name | 1-[3-(2-aminophenoxy)propyl]-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62928552 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[3-(2-aminophenoxy)propyl]-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(CCCOc2ccccc2N)c(=O)c1=O |
| InChI | InChI=1S/C14H17N3O3/c1-16-8-9-17(14(19)13(16)18)7-4-10-20-12-6-3-2-5-11(12)15/h2-3,5-6,8-9H,4,7,10,15H2,1H3 |
| InChIKey | KCKJLIRVZADQKF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|