About 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione
1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione (PubChem CID 62928731) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione.
Molecular Properties
| Compound Name | 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione |
| PubChem CID | 62928731 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(CC(N)C(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C11H19N3O2/c1-11(2,3)8(12)7-14-6-5-13(4)9(15)10(14)16/h5-6,8H,7,12H2,1-4H3 |
| InChIKey | UETZNHQTQWPXKA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione?
The IUPAC name of 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione (CID 62928731) is 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione.
What is the SMILES notation for 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione?
The canonical SMILES for 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione is Cn1ccn(CC(N)C(C)(C)C)c(=O)c1=O.
What is the InChIKey of 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione?
The InChIKey is UETZNHQTQWPXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-11(2,3)8(12)7-14-6-5-13(4)9(15)10(14)16/h5-6,8H,7,12H2,1-4H3.
What are the key properties of 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione?
1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione has a molecular weight of 225.29 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-3,3-dimethylbutyl)-4-methylpyrazine-2,3-dione is sourced from PubChem (CID 62928731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).