C9H12F3N3O2 — CID 62928749
1-methyl-4-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazine-2,3-dione (PubChem CID 62928749) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 1-methyl-4-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazine-2,3-dione.
| Compound Name | 1-methyl-4-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 62928749 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-methyl-4-[2-(2,2,2-trifluoroethylamino)ethyl]pyrazine-2,3-dione |
| SMILES | Cn1ccn(CCNCC(F)(F)F)c(=O)c1=O |
| InChI | InChI=1S/C9H12F3N3O2/c1-14-4-5-15(8(17)7(14)16)3-2-13-6-9(10,11)12/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | KDEKVAPTLCLZSW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|