C8H10F3N3O2 — CID 62929603
1-(3-amino-1,1,1-trifluoropropan-2-yl)-4-methylpyrazine-2,3-dione (PubChem CID 62929603) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluoropropan-2-yl)-4-methylpyrazine-2,3-dione.
| Compound Name | 1-(3-amino-1,1,1-trifluoropropan-2-yl)-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62929603 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluoropropan-2-yl)-4-methylpyrazine-2,3-dione |
| SMILES | Cn1ccn(C(CN)C(F)(F)F)c(=O)c1=O |
| InChI | InChI=1S/C8H10F3N3O2/c1-13-2-3-14(7(16)6(13)15)5(4-12)8(9,10)11/h2-3,5H,4,12H2,1H3 |
| InChIKey | NMKXYRROXJFKDX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|