About 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine
2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 62929822) has the molecular formula C7H12N2OS
and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine |
| PubChem CID | 62929822 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | COCc1nc(CCN)cs1 |
| InChI | InChI=1S/C7H12N2OS/c1-10-4-7-9-6(2-3-8)5-11-7/h5H,2-4,8H2,1H3 |
| InChIKey | STIDTJSTNIVKIR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine?
The IUPAC name of 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine (CID 62929822) is 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine.
What is the SMILES notation for 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine?
The canonical SMILES for 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine is COCc1nc(CCN)cs1.
What is the InChIKey of 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine?
The InChIKey is STIDTJSTNIVKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS/c1-10-4-7-9-6(2-3-8)5-11-7/h5H,2-4,8H2,1H3.
What are the key properties of 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine?
2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine has a molecular weight of 172.25 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methoxymethyl)-1,3-thiazol-4-yl]ethanamine is sourced from PubChem (CID 62929822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).