C15H22N2O3 — CID 62930557
1-[4-(4,4-dimethylpiperidin-1-yl)-3-nitrophenyl]ethanol (PubChem CID 62930557) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[4-(4,4-dimethylpiperidin-1-yl)-3-nitrophenyl]ethanol.
| Compound Name | 1-[4-(4,4-dimethylpiperidin-1-yl)-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 62930557 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[4-(4,4-dimethylpiperidin-1-yl)-3-nitrophenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCC(C)(C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N2O3/c1-11(18)12-4-5-13(14(10-12)17(19)20)16-8-6-15(2,3)7-9-16/h4-5,10-11,18H,6-9H2,1-3H3 |
| InChIKey | OEQGOWFLDIVRTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|