About methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate
methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate (PubChem CID 629306) has the molecular formula C25H40O10
and a molecular weight of 500.59 g/mol. Its IUPAC name is methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate |
| PubChem CID | 629306 |
| Molecular Formula | C25H40O10 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate |
| SMILES | COC(=O)CCC1C(OC(C)=O)CC(OC(C)=O)C1CCC(CCCCCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C25H40O10/c1-16(26)32-14-8-6-7-9-20(33-17(2)27)10-11-21-22(12-13-25(30)31-5)24(35-19(4)29)15-23(21)34-18(3)28/h20-24H,6-15H2,1-5H3 |
| InChIKey | ASYXZUZBXQYYQY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate?
The IUPAC name of methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate (CID 629306) is methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate.
What is the SMILES notation for methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate?
The canonical SMILES for methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate is COC(=O)CCC1C(OC(C)=O)CC(OC(C)=O)C1CCC(CCCCCOC(C)=O)OC(C)=O.
What is the InChIKey of methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate?
The InChIKey is ASYXZUZBXQYYQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O10/c1-16(26)32-14-8-6-7-9-20(33-17(2)27)10-11-21-22(12-13-25(30)31-5)24(35-19(4)29)15-23(21)34-18(3)28/h20-24H,6-15H2,1-5H3.
What are the key properties of methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate?
methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate has a molecular weight of 500.59 g/mol, XLogP of 3.27, 15 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3,5-diacetyloxy-2-(3,8-diacetyloxyoctyl)cyclopentyl]propanoate is sourced from PubChem (CID 629306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).